ETHYL HEXYL ACRYLATE; 2-Ethyl Hexyl Acrylate; Viết tắt.: EHA / 2-EHA; Công thức hóa học : C11H20O2; CAS no.: 103-11-7; HS code: 2916.12.5000.

ETHYL HEXYL ACRYLATE / 2-Ethyl Hexyl Acrylate

Viết tắt : EHA / 2-EHA

Công thức hóa học : C₁₁H₂₀O₂

CAS no.: 103-11-7.

HS code: 2916.12.5000.

2-Ethylhexyl acrylate (2-EHA) là một loại hợp chất hóa học thuộc nhóm este acrylic, với công thức hóa học CH2=CHCOOCH2CH(C2H5)(CH2)3CH3. Đây là một loại monomer có ứng dụng phổ biến trong ngành công nghiệp hóa chất và sản xuất polymer acrylic. 2-EHA thường được sử dụng trong sản xuất các sản phẩm như sơn, keo, chất phủ, và màng chống thấm. Nó cũng có ứng dụng trong việc sản xuất polymer tạo tính chịu hóa chất và tính linh hoạt, được sử dụng trong nhiều lĩnh vực công nghiệp khác nhau.

Ứng dụng của Ethyl Hexyl Phthalate / 2-Ethyl Hexyl Phthalate:

2-Ethylhexyl acrylate (2-EHA) có nhiều ứng dụng trong ngành công nghiệp hóa chất và sản xuất, bao gồm:

1. Sơn và Chất phủ: 2-EHA được sử dụng phổ biến trong sản xuất sơn và chất phủ do khả năng tạo độ co ngót và kháng hóa chất tốt.

2. Keo và Màng chống thấm: 2-EHA cũng được sử dụng để sản xuất keo và màng chống thấm với đặc tính linh hoạt và khả năng chống nước tốt.

3. Polymer Acrylic: Là một loại monomer chính, 2-EHA được sử dụng để sản xuất polymer acrylic, có ứng dụng trong mực in, sợi tổng hợp, và sản phẩm chống thấm.

4. Vật liệu cách nhiệt và chịu hóa chất: Chất polymer từ 2-EHA cũng được sử dụng trong sản xuất vật liệu cách nhiệt và chịu hóa chất.

5. Công nghiệp y tế: 2-EHA cũng có ứng dụng trong sản xuất các sản phẩm y tế như băng dính y tế, găng tay cao su, và vật liệu y tế dùng một lần.

Đây chỉ là một số ví dụ về ứng dụng của 2-Ethylhexyl acrylate và loại hỗn hợp này cũng có thể được sử dụng trong nhiều ứng dụng khác tùy thuộc vào yêu cầu cụ thể của sản xuất và công nghiệp.

------------------------------------------THCHEMICALS---------------------------------------------

ETHYL HEXYL ACRYLATE / 2-Ethyl Hexyl Acrylate

Abbr.: EHA / 2-EHA

Formula : C₁₁H₂₀O₂

CAS no.: 103-11-7.

HS code: 2916.12.5000.

2-Ethylhexyl acrylate, also known as 2-EHA, is a chemical compound with the molecular formula C₁₁H₂₀O₂. It is classified as an acrylic ester and is derived from the reaction between acrylic acid and 2-ethylhexanol. This colorless liquid is known for its characteristic odor and is primarily used as a monomer in the production of various polymers and resins. 2-Ethylhexyl acrylate is valued for its versatility and is utilized in the manufacturing of adhesives, coatings, and other polymer-based products due to its ability to enhance adhesion, flexibility, and durability.

Application of Ethyl Hexyl Acrylate / 2-Ethyl Hexyl Acrylate: 

2-Ethylhexyl acrylate (2-EHA) finds application in various industrial and commercial sectors due to its versatile properties. Some common applications include:

1. Adhesives: 2-EHA is used in the production of adhesives, where it contributes to the adhesive's ability to bond to diverse substrates and provides essential properties such as flexibility and toughness.

2. Coatings: It is a key component in the manufacturing of various types of coatings, including architectural coatings, industrial coatings, and automotive coatings, due to its ability to improve adhesion and impact resistance.

3. Sealants: 2-Ethylhexyl acrylate is employed in sealant formulations, contributing to the sealant's ability to adhere to different surfaces and provide flexibility and weather resistance.

4. Emulsion Polymers: It serves as a monomer in the production of emulsion polymers, which are used in applications such as paper coatings, textiles, and adhesives.

5. Textile Chemicals: The compound is used in the production of textile chemicals to provide properties such as water repellency, wrinkle resistance, and durability to textile finishes.

These applications underscore the significance of 2-Ethylhexyl acrylate in various industries, emphasizing its role in the formulation of adhesives, coatings, sealants, and other polymer-based products.

--------------------Thchemicals-----------------------

Name : Trần Hưng Cường (Mr.) called W.CUONG 

  Add : District 10 - Hồ chí minh city - ViệtNam. 

    Email: thchemicals@gmail.com.com 

     Tel : +84909919331 <> +84907-919-331